C15H22ClF2N — CID 107476596
1-(2-chloro-4,5-difluorophenyl)-2-ethyl-N-propylbutan-1-amine (PubChem CID 107476596) has the molecular formula C15H22ClF2N and a molecular weight of 289.80 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-2-ethyl-N-propylbutan-1-amine.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-2-ethyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 107476596 |
| Molecular Formula | C15H22ClF2N |
| Molecular Weight | 289.80 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-2-ethyl-N-propylbutan-1-amine |
| SMILES | CCCNC(c1cc(F)c(F)cc1Cl)C(CC)CC |
| InChI | InChI=1S/C15H22ClF2N/c1-4-7-19-15(10(5-2)6-3)11-8-13(17)14(18)9-12(11)16/h8-10,15,19H,4-7H2,1-3H3 |
| InChIKey | BOINBYVUSIBCNN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.80 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|