C16H18ClF2NS — CID 107476619
N-[(2-chloro-4,5-difluorophenyl)-(4,5-dimethylthiophen-2-yl)methyl]propan-1-amine (PubChem CID 107476619) has the molecular formula C16H18ClF2NS and a molecular weight of 329.84 g/mol. Its IUPAC name is N-[(2-chloro-4,5-difluorophenyl)-(4,5-dimethylthiophen-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(2-chloro-4,5-difluorophenyl)-(4,5-dimethylthiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107476619 |
| Molecular Formula | C16H18ClF2NS |
| Molecular Weight | 329.84 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-[(2-chloro-4,5-difluorophenyl)-(4,5-dimethylthiophen-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cc(C)c(C)s1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C16H18ClF2NS/c1-4-5-20-16(15-6-9(2)10(3)21-15)11-7-13(18)14(19)8-12(11)17/h6-8,16,20H,4-5H2,1-3H3 |
| InChIKey | LLYMCZPQEXFEKR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.84 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|