C15H16ClF2NO — CID 107476682
N-[(2-chloro-4,5-difluorophenyl)-(2-methylfuran-3-yl)methyl]propan-1-amine (PubChem CID 107476682) has the molecular formula C15H16ClF2NO and a molecular weight of 299.75 g/mol. Its IUPAC name is N-[(2-chloro-4,5-difluorophenyl)-(2-methylfuran-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(2-chloro-4,5-difluorophenyl)-(2-methylfuran-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107476682 |
| Molecular Formula | C15H16ClF2NO |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-[(2-chloro-4,5-difluorophenyl)-(2-methylfuran-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cc(F)c(F)cc1Cl)c1ccoc1C |
| InChI | InChI=1S/C15H16ClF2NO/c1-3-5-19-15(10-4-6-20-9(10)2)11-7-13(17)14(18)8-12(11)16/h4,6-8,15,19H,3,5H2,1-2H3 |
| InChIKey | RIUSKDWOAUNMIB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|