C13H22ClNO — CID 106692647
1-(2-chlorofuran-3-yl)-2-ethyl-N-propylbutan-1-amine (PubChem CID 106692647) has the molecular formula C13H22ClNO and a molecular weight of 243.78 g/mol. Its IUPAC name is 1-(2-chlorofuran-3-yl)-2-ethyl-N-propylbutan-1-amine.
| Compound Name | 1-(2-chlorofuran-3-yl)-2-ethyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 106692647 |
| Molecular Formula | C13H22ClNO |
| Molecular Weight | 243.78 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-(2-chlorofuran-3-yl)-2-ethyl-N-propylbutan-1-amine |
| SMILES | CCCNC(c1ccoc1Cl)C(CC)CC |
| InChI | InChI=1S/C13H22ClNO/c1-4-8-15-12(10(5-2)6-3)11-7-9-16-13(11)14/h7,9-10,12,15H,4-6,8H2,1-3H3 |
| InChIKey | MGHLPTYLAWWVOF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.78 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |