C12H20ClNO — CID 106691699
1-(2-chlorofuran-3-yl)-N-propylpentan-1-amine (PubChem CID 106691699) has the molecular formula C12H20ClNO and a molecular weight of 229.75 g/mol. Its IUPAC name is 1-(2-chlorofuran-3-yl)-N-propylpentan-1-amine.
| Compound Name | 1-(2-chlorofuran-3-yl)-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 106691699 |
| Molecular Formula | C12H20ClNO |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 1-(2-chlorofuran-3-yl)-N-propylpentan-1-amine |
| SMILES | CCCCC(NCCC)c1ccoc1Cl |
| InChI | InChI=1S/C12H20ClNO/c1-3-5-6-11(14-8-4-2)10-7-9-15-12(10)13/h7,9,11,14H,3-6,8H2,1-2H3 |
| InChIKey | IFJYEJOJZVAYPI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |