C13H17Cl2N3O — CID 106693110
N-[(4-chloro-1-ethylpyrazol-5-yl)-(2-chlorofuran-3-yl)methyl]propan-1-amine (PubChem CID 106693110) has the molecular formula C13H17Cl2N3O and a molecular weight of 302.20 g/mol. Its IUPAC name is N-[(4-chloro-1-ethylpyrazol-5-yl)-(2-chlorofuran-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(4-chloro-1-ethylpyrazol-5-yl)-(2-chlorofuran-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106693110 |
| Molecular Formula | C13H17Cl2N3O |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-[(4-chloro-1-ethylpyrazol-5-yl)-(2-chlorofuran-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccoc1Cl)c1c(Cl)cnn1CC |
| InChI | InChI=1S/C13H17Cl2N3O/c1-3-6-16-11(9-5-7-19-13(9)15)12-10(14)8-17-18(12)4-2/h5,7-8,11,16H,3-4,6H2,1-2H3 |
| InChIKey | AGFIGBYKVODQJW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |