C13H17Cl2N3O2 — CID 106693372
N-[(2-chlorofuran-3-yl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methyl]ethanamine (PubChem CID 106693372) has the molecular formula C13H17Cl2N3O2 and a molecular weight of 318.20 g/mol. Its IUPAC name is N-[(2-chlorofuran-3-yl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methyl]ethanamine.
| Compound Name | N-[(2-chlorofuran-3-yl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 106693372 |
| Molecular Formula | C13H17Cl2N3O2 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-[(2-chlorofuran-3-yl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methyl]ethanamine |
| SMILES | CCNC(c1ccoc1Cl)c1c(Cl)cnn1CCOC |
| InChI | InChI=1S/C13H17Cl2N3O2/c1-3-16-11(9-4-6-20-13(9)15)12-10(14)8-17-18(12)5-7-19-2/h4,6,8,11,16H,3,5,7H2,1-2H3 |
| InChIKey | GSUOCRGPQQZYBN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 52.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |