C14H26ClN3OS — CID 114653915
1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-N-ethyl-2-(2-methylpropylsulfanyl)ethanamine (PubChem CID 114653915) has the molecular formula C14H26ClN3OS and a molecular weight of 319.90 g/mol. Its IUPAC name is 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-N-ethyl-2-(2-methylpropylsulfanyl)ethanamine.
| Compound Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-N-ethyl-2-(2-methylpropylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 114653915 |
| Molecular Formula | C14H26ClN3OS |
| Molecular Weight | 319.90 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-N-ethyl-2-(2-methylpropylsulfanyl)ethanamine |
| SMILES | CCNC(CSCC(C)C)c1c(Cl)cnn1CCOC |
| InChI | InChI=1S/C14H26ClN3OS/c1-5-16-13(10-20-9-11(2)3)14-12(15)8-17-18(14)6-7-19-4/h8,11,13,16H,5-7,9-10H2,1-4H3 |
| InChIKey | FJBFWJHNOCMHLH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.90 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |