C12H22ClN3OS — CID 114653578
1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-N-methyl-2-propylsulfanylethanamine (PubChem CID 114653578) has the molecular formula C12H22ClN3OS and a molecular weight of 291.85 g/mol. Its IUPAC name is 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-N-methyl-2-propylsulfanylethanamine.
| Compound Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-N-methyl-2-propylsulfanylethanamine |
|---|---|
| PubChem CID | 114653578 |
| Molecular Formula | C12H22ClN3OS |
| Molecular Weight | 291.85 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-N-methyl-2-propylsulfanylethanamine |
| SMILES | CCCSCC(NC)c1c(Cl)cnn1CCOC |
| InChI | InChI=1S/C12H22ClN3OS/c1-4-7-18-9-11(14-2)12-10(13)8-15-16(12)5-6-17-3/h8,11,14H,4-7,9H2,1-3H3 |
| InChIKey | ZOGIYMXCZWEBCN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.85 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|