C15H28ClN3O — CID 105054531
1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-ethyl-N-methylhexan-1-amine (PubChem CID 105054531) has the molecular formula C15H28ClN3O and a molecular weight of 301.86 g/mol. Its IUPAC name is 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-ethyl-N-methylhexan-1-amine.
| Compound Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-ethyl-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 105054531 |
| Molecular Formula | C15H28ClN3O |
| Molecular Weight | 301.86 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-ethyl-N-methylhexan-1-amine |
| SMILES | CCCCC(CC)C(NC)c1c(Cl)cnn1CCOC |
| InChI | InChI=1S/C15H28ClN3O/c1-5-7-8-12(6-2)14(17-3)15-13(16)11-18-19(15)9-10-20-4/h11-12,14,17H,5-10H2,1-4H3 |
| InChIKey | NAKXDRVXBJHCDZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.86 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |