C9H14ClF3N4O — CID 105205931
[1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-3,3,3-trifluoropropyl]hydrazine (PubChem CID 105205931) has the molecular formula C9H14ClF3N4O and a molecular weight of 286.69 g/mol. Its IUPAC name is [1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-3,3,3-trifluoropropyl]hydrazine.
| Compound Name | [1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-3,3,3-trifluoropropyl]hydrazine |
|---|---|
| PubChem CID | 105205931 |
| Molecular Formula | C9H14ClF3N4O |
| Molecular Weight | 286.69 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | [1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-3,3,3-trifluoropropyl]hydrazine |
| SMILES | COCCn1ncc(Cl)c1C(CC(F)(F)F)NN |
| InChI | InChI=1S/C9H14ClF3N4O/c1-18-3-2-17-8(6(10)5-15-17)7(16-14)4-9(11,12)13/h5,7,16H,2-4,14H2,1H3 |
| InChIKey | ZTFOFHXUJUAVCK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.69 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|