C8H13ClF2N4O — CID 105265036
[1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2,2-difluoroethyl]hydrazine (PubChem CID 105265036) has the molecular formula C8H13ClF2N4O and a molecular weight of 254.67 g/mol. Its IUPAC name is [1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2,2-difluoroethyl]hydrazine.
| Compound Name | [1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2,2-difluoroethyl]hydrazine |
|---|---|
| PubChem CID | 105265036 |
| Molecular Formula | C8H13ClF2N4O |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | [1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2,2-difluoroethyl]hydrazine |
| SMILES | COCCn1ncc(Cl)c1C(NN)C(F)F |
| InChI | InChI=1S/C8H13ClF2N4O/c1-16-3-2-15-7(5(9)4-13-15)6(14-12)8(10)11/h4,6,8,14H,2-3,12H2,1H3 |
| InChIKey | YMSBYOFKQVENPO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|