C10H18ClN3O3 — CID 114657526
1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2,2-dimethoxyethanamine (PubChem CID 114657526) has the molecular formula C10H18ClN3O3 and a molecular weight of 263.73 g/mol. Its IUPAC name is 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2,2-dimethoxyethanamine.
| Compound Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2,2-dimethoxyethanamine |
|---|---|
| PubChem CID | 114657526 |
| Molecular Formula | C10H18ClN3O3 |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2,2-dimethoxyethanamine |
| SMILES | COCCn1ncc(Cl)c1C(N)C(OC)OC |
| InChI | InChI=1S/C10H18ClN3O3/c1-15-5-4-14-9(7(11)6-13-14)8(12)10(16-2)17-3/h6,8,10H,4-5,12H2,1-3H3 |
| InChIKey | NHMQMDBJUAAAHE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|