C11H19ClN2O3 — CID 114645459
1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-3-methoxybutan-1-ol (PubChem CID 114645459) has the molecular formula C11H19ClN2O3 and a molecular weight of 262.74 g/mol. Its IUPAC name is 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-3-methoxybutan-1-ol.
| Compound Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-3-methoxybutan-1-ol |
|---|---|
| PubChem CID | 114645459 |
| Molecular Formula | C11H19ClN2O3 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-3-methoxybutan-1-ol |
| SMILES | COCCn1ncc(Cl)c1C(O)CC(C)OC |
| InChI | InChI=1S/C11H19ClN2O3/c1-8(17-3)6-10(15)11-9(12)7-13-14(11)4-5-16-2/h7-8,10,15H,4-6H2,1-3H3 |
| InChIKey | GGBPIRSXQQDGRR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |