C12H21ClN2O2 — CID 115839361
1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-3-methylpentan-1-ol (PubChem CID 115839361) has the molecular formula C12H21ClN2O2 and a molecular weight of 260.76 g/mol. Its IUPAC name is 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-3-methylpentan-1-ol.
| Compound Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 115839361 |
| Molecular Formula | C12H21ClN2O2 |
| Molecular Weight | 260.76 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-3-methylpentan-1-ol |
| SMILES | CCC(C)CC(O)c1c(Cl)cnn1CCOC |
| InChI | InChI=1S/C12H21ClN2O2/c1-4-9(2)7-11(16)12-10(13)8-14-15(12)5-6-17-3/h8-9,11,16H,4-7H2,1-3H3 |
| InChIKey | BOSYPRUVNADZPP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.76 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |