C12H21ClN2O3 — CID 105132601
1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-4-methoxypentan-1-ol (PubChem CID 105132601) has the molecular formula C12H21ClN2O3 and a molecular weight of 276.76 g/mol. Its IUPAC name is 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-4-methoxypentan-1-ol.
| Compound Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-4-methoxypentan-1-ol |
|---|---|
| PubChem CID | 105132601 |
| Molecular Formula | C12H21ClN2O3 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-4-methoxypentan-1-ol |
| SMILES | COCCn1ncc(Cl)c1C(O)CCC(C)OC |
| InChI | InChI=1S/C12H21ClN2O3/c1-9(18-3)4-5-11(16)12-10(13)8-14-15(12)6-7-17-2/h8-9,11,16H,4-7H2,1-3H3 |
| InChIKey | QSAHJWIHMFWZPU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |