C12H21ClN2O4 — CID 102927629
1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-3-(2-methoxyethoxy)propan-1-ol (PubChem CID 102927629) has the molecular formula C12H21ClN2O4 and a molecular weight of 292.76 g/mol. Its IUPAC name is 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-3-(2-methoxyethoxy)propan-1-ol.
| Compound Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-3-(2-methoxyethoxy)propan-1-ol |
|---|---|
| PubChem CID | 102927629 |
| Molecular Formula | C12H21ClN2O4 |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-3-(2-methoxyethoxy)propan-1-ol |
| SMILES | COCCOCCC(O)c1c(Cl)cnn1CCOC |
| InChI | InChI=1S/C12H21ClN2O4/c1-17-6-4-15-12(10(13)9-14-15)11(16)3-5-19-8-7-18-2/h9,11,16H,3-8H2,1-2H3 |
| InChIKey | FJWKGPYXYCLPIY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|