C10H17ClN2O2 — CID 114634657
1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-methylpropan-1-ol (PubChem CID 114634657) has the molecular formula C10H17ClN2O2 and a molecular weight of 232.71 g/mol. Its IUPAC name is 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-methylpropan-1-ol.
| Compound Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 114634657 |
| Molecular Formula | C10H17ClN2O2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-methylpropan-1-ol |
| SMILES | COCCn1ncc(Cl)c1C(O)C(C)C |
| InChI | InChI=1S/C10H17ClN2O2/c1-7(2)10(14)9-8(11)6-12-13(9)4-5-15-3/h6-7,10,14H,4-5H2,1-3H3 |
| InChIKey | RUTHAGMRYCPNJT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |