C12H13Cl2N3O2 — CID 114644952
[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(6-chloro-3-pyridinyl)methanol (PubChem CID 114644952) has the molecular formula C12H13Cl2N3O2 and a molecular weight of 302.16 g/mol. Its IUPAC name is [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(6-chloro-3-pyridinyl)methanol.
| Compound Name | [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(6-chloro-3-pyridinyl)methanol |
|---|---|
| PubChem CID | 114644952 |
| Molecular Formula | C12H13Cl2N3O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(6-chloro-3-pyridinyl)methanol |
| SMILES | COCCn1ncc(Cl)c1C(O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H13Cl2N3O2/c1-19-5-4-17-11(9(13)7-16-17)12(18)8-2-3-10(14)15-6-8/h2-3,6-7,12,18H,4-5H2,1H3 |
| InChIKey | FKVNVJFHGNZCFQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|