C16H19ClN2O2 — CID 114636920
[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(3-cyclopropylphenyl)methanol (PubChem CID 114636920) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(3-cyclopropylphenyl)methanol.
| Compound Name | [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(3-cyclopropylphenyl)methanol |
|---|---|
| PubChem CID | 114636920 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(3-cyclopropylphenyl)methanol |
| SMILES | COCCn1ncc(Cl)c1C(O)c1cccc(C2CC2)c1 |
| InChI | InChI=1S/C16H19ClN2O2/c1-21-8-7-19-15(14(17)10-18-19)16(20)13-4-2-3-12(9-13)11-5-6-11/h2-4,9-11,16,20H,5-8H2,1H3 |
| InChIKey | HHRVSSXYJWDCJD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |