C12H24ClN5O — CID 105238898
1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-1-hydrazinyl-N,N,2-trimethylpropan-2-amine (PubChem CID 105238898) has the molecular formula C12H24ClN5O and a molecular weight of 289.81 g/mol. Its IUPAC name is 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-1-hydrazinyl-N,N,2-trimethylpropan-2-amine.
| Compound Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-1-hydrazinyl-N,N,2-trimethylpropan-2-amine |
|---|---|
| PubChem CID | 105238898 |
| Molecular Formula | C12H24ClN5O |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-1-hydrazinyl-N,N,2-trimethylpropan-2-amine |
| SMILES | COCCn1ncc(Cl)c1C(NN)C(C)(C)N(C)C |
| InChI | InChI=1S/C12H24ClN5O/c1-12(2,17(3)4)11(16-14)10-9(13)8-15-18(10)6-7-19-5/h8,11,16H,6-7,14H2,1-5H3 |
| InChIKey | SKHPUYJCCUQCBM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|