C10H18BrN3OS — CID 114649769
1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-methyl-2-methylsulfanylethanamine (PubChem CID 114649769) has the molecular formula C10H18BrN3OS and a molecular weight of 308.25 g/mol. Its IUPAC name is 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-methyl-2-methylsulfanylethanamine.
| Compound Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-methyl-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 114649769 |
| Molecular Formula | C10H18BrN3OS |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-methyl-2-methylsulfanylethanamine |
| SMILES | CNC(CSC)c1c(Br)cnn1CCOC |
| InChI | InChI=1S/C10H18BrN3OS/c1-12-9(7-16-3)10-8(11)6-13-14(10)4-5-15-2/h6,9,12H,4-5,7H2,1-3H3 |
| InChIKey | CBJXLPSBCZBYPM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |