C11H20BrN3O — CID 114666706
3-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-methylbutan-1-amine (PubChem CID 114666706) has the molecular formula C11H20BrN3O and a molecular weight of 290.21 g/mol. Its IUPAC name is 3-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-methylbutan-1-amine.
| Compound Name | 3-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 114666706 |
| Molecular Formula | C11H20BrN3O |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 3-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-methylbutan-1-amine |
| SMILES | CNCCC(C)c1c(Br)cnn1CCOC |
| InChI | InChI=1S/C11H20BrN3O/c1-9(4-5-13-2)11-10(12)8-14-15(11)6-7-16-3/h8-9,13H,4-7H2,1-3H3 |
| InChIKey | ILSSJBNWJTYNLA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |