C11H21BrN4O2 — CID 105222964
[1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-ethoxypropyl]hydrazine (PubChem CID 105222964) has the molecular formula C11H21BrN4O2 and a molecular weight of 321.22 g/mol. Its IUPAC name is [1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-ethoxypropyl]hydrazine.
| Compound Name | [1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-ethoxypropyl]hydrazine |
|---|---|
| PubChem CID | 105222964 |
| Molecular Formula | C11H21BrN4O2 |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-ethoxypropyl]hydrazine |
| SMILES | CCOC(C)C(NN)c1c(Br)cnn1CCOC |
| InChI | InChI=1S/C11H21BrN4O2/c1-4-18-8(2)10(15-13)11-9(12)7-14-16(11)5-6-17-3/h7-8,10,15H,4-6,13H2,1-3H3 |
| InChIKey | DOCVRNBNVZKGRZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|