C11H22BrN5O — CID 105246875
2-[4-bromo-5-(1-hydrazinyl-2-methoxypropyl)pyrazol-1-yl]-N,N-dimethylethanamine (PubChem CID 105246875) has the molecular formula C11H22BrN5O and a molecular weight of 320.24 g/mol. Its IUPAC name is 2-[4-bromo-5-(1-hydrazinyl-2-methoxypropyl)pyrazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-bromo-5-(1-hydrazinyl-2-methoxypropyl)pyrazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 105246875 |
| Molecular Formula | C11H22BrN5O |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-[4-bromo-5-(1-hydrazinyl-2-methoxypropyl)pyrazol-1-yl]-N,N-dimethylethanamine |
| SMILES | COC(C)C(NN)c1c(Br)cnn1CCN(C)C |
| InChI | InChI=1S/C11H22BrN5O/c1-8(18-4)10(15-13)11-9(12)7-14-17(11)6-5-16(2)3/h7-8,10,15H,5-6,13H2,1-4H3 |
| InChIKey | DMCSEPQMILEVSF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|