C14H21BrN6 — CID 105223775
2-[[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-hydrazinylmethyl]aniline (PubChem CID 105223775) has the molecular formula C14H21BrN6 and a molecular weight of 353.27 g/mol. Its IUPAC name is 2-[[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-hydrazinylmethyl]aniline.
| Compound Name | 2-[[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-hydrazinylmethyl]aniline |
|---|---|
| PubChem CID | 105223775 |
| Molecular Formula | C14H21BrN6 |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-[[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-hydrazinylmethyl]aniline |
| SMILES | CN(C)CCn1ncc(Br)c1C(NN)c1ccccc1N |
| InChI | InChI=1S/C14H21BrN6/c1-20(2)7-8-21-14(11(15)9-18-21)13(19-17)10-5-3-4-6-12(10)16/h3-6,9,13,19H,7-8,16-17H2,1-2H3 |
| InChIKey | UMHLYJNQWYJGQX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|