C12H16BrN5 — CID 105223904
2-[(4-bromo-1-ethylpyrazol-5-yl)-hydrazinylmethyl]aniline (PubChem CID 105223904) has the molecular formula C12H16BrN5 and a molecular weight of 310.20 g/mol. Its IUPAC name is 2-[(4-bromo-1-ethylpyrazol-5-yl)-hydrazinylmethyl]aniline.
| Compound Name | 2-[(4-bromo-1-ethylpyrazol-5-yl)-hydrazinylmethyl]aniline |
|---|---|
| PubChem CID | 105223904 |
| Molecular Formula | C12H16BrN5 |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-[(4-bromo-1-ethylpyrazol-5-yl)-hydrazinylmethyl]aniline |
| SMILES | CCn1ncc(Br)c1C(NN)c1ccccc1N |
| InChI | InChI=1S/C12H16BrN5/c1-2-18-12(9(13)7-16-18)11(17-15)8-5-3-4-6-10(8)14/h3-7,11,17H,2,14-15H2,1H3 |
| InChIKey | OGKYYUAUIHXMRJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|