C10H16BrN7S — CID 105336482
2-[4-bromo-5-[hydrazinyl(thiadiazol-5-yl)methyl]pyrazol-1-yl]-N,N-dimethylethanamine (PubChem CID 105336482) has the molecular formula C10H16BrN7S and a molecular weight of 346.26 g/mol. Its IUPAC name is 2-[4-bromo-5-[hydrazinyl(thiadiazol-5-yl)methyl]pyrazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-bromo-5-[hydrazinyl(thiadiazol-5-yl)methyl]pyrazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 105336482 |
| Molecular Formula | C10H16BrN7S |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2-[4-bromo-5-[hydrazinyl(thiadiazol-5-yl)methyl]pyrazol-1-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1ncc(Br)c1C(NN)c1cnns1 |
| InChI | InChI=1S/C10H16BrN7S/c1-17(2)3-4-18-10(7(11)5-14-18)9(15-12)8-6-13-16-19-8/h5-6,9,15H,3-4,12H2,1-2H3 |
| InChIKey | CLYLMGYJVDKJSE-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|