C12H19BrN6S — CID 105336514
2-[4-bromo-5-[hydrazinyl-(2-methyl-1,3-thiazol-4-yl)methyl]pyrazol-1-yl]-N,N-dimethylethanamine (PubChem CID 105336514) has the molecular formula C12H19BrN6S and a molecular weight of 359.30 g/mol. Its IUPAC name is 2-[4-bromo-5-[hydrazinyl-(2-methyl-1,3-thiazol-4-yl)methyl]pyrazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-bromo-5-[hydrazinyl-(2-methyl-1,3-thiazol-4-yl)methyl]pyrazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 105336514 |
| Molecular Formula | C12H19BrN6S |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 2-[4-bromo-5-[hydrazinyl-(2-methyl-1,3-thiazol-4-yl)methyl]pyrazol-1-yl]-N,N-dimethylethanamine |
| SMILES | Cc1nc(C(NN)c2c(Br)cnn2CCN(C)C)cs1 |
| InChI | InChI=1S/C12H19BrN6S/c1-8-16-10(7-20-8)11(17-14)12-9(13)6-15-19(12)5-4-18(2)3/h6-7,11,17H,4-5,14H2,1-3H3 |
| InChIKey | AFDPTQPZQLHNFJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|