C11H16BrN5OS — CID 105337332
[[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(2-methyl-1,3-thiazol-4-yl)methyl]hydrazine (PubChem CID 105337332) has the molecular formula C11H16BrN5OS and a molecular weight of 346.25 g/mol. Its IUPAC name is [[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(2-methyl-1,3-thiazol-4-yl)methyl]hydrazine.
| Compound Name | [[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(2-methyl-1,3-thiazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105337332 |
| Molecular Formula | C11H16BrN5OS |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | [[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(2-methyl-1,3-thiazol-4-yl)methyl]hydrazine |
| SMILES | COCCn1ncc(Br)c1C(NN)c1csc(C)n1 |
| InChI | InChI=1S/C11H16BrN5OS/c1-7-15-9(6-19-7)10(16-13)11-8(12)5-14-17(11)3-4-18-2/h5-6,10,16H,3-4,13H2,1-2H3 |
| InChIKey | HCSYECCQWADDQV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|