C12H19BrN6OS — CID 105337391
[[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(4-propan-2-ylthiadiazol-5-yl)methyl]hydrazine (PubChem CID 105337391) has the molecular formula C12H19BrN6OS and a molecular weight of 375.30 g/mol. Its IUPAC name is [[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(4-propan-2-ylthiadiazol-5-yl)methyl]hydrazine.
| Compound Name | [[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(4-propan-2-ylthiadiazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105337391 |
| Molecular Formula | C12H19BrN6OS |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | [[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(4-propan-2-ylthiadiazol-5-yl)methyl]hydrazine |
| SMILES | COCCn1ncc(Br)c1C(NN)c1snnc1C(C)C |
| InChI | InChI=1S/C12H19BrN6OS/c1-7(2)9-12(21-18-17-9)10(16-14)11-8(13)6-15-19(11)4-5-20-3/h6-7,10,16H,4-5,14H2,1-3H3 |
| InChIKey | LOLNETKRMPQEDI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|