C12H20BrN7 — CID 105228636
2-[4-bromo-5-[hydrazinyl-(1-methylpyrazol-3-yl)methyl]pyrazol-1-yl]-N,N-dimethylethanamine (PubChem CID 105228636) has the molecular formula C12H20BrN7 and a molecular weight of 342.25 g/mol. Its IUPAC name is 2-[4-bromo-5-[hydrazinyl-(1-methylpyrazol-3-yl)methyl]pyrazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-bromo-5-[hydrazinyl-(1-methylpyrazol-3-yl)methyl]pyrazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 105228636 |
| Molecular Formula | C12H20BrN7 |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-[4-bromo-5-[hydrazinyl-(1-methylpyrazol-3-yl)methyl]pyrazol-1-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1ncc(Br)c1C(NN)c1ccn(C)n1 |
| InChI | InChI=1S/C12H20BrN7/c1-18(2)6-7-20-12(9(13)8-15-20)11(16-14)10-4-5-19(3)17-10/h4-5,8,11,16H,6-7,14H2,1-3H3 |
| InChIKey | CWRVEJJLUQLHJK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 76.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|