C14H17BrIN3O — CID 115834987
[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-iodophenyl)methanol (PubChem CID 115834987) has the molecular formula C14H17BrIN3O and a molecular weight of 450.12 g/mol. Its IUPAC name is [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-iodophenyl)methanol.
| Compound Name | [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-iodophenyl)methanol |
|---|---|
| PubChem CID | 115834987 |
| Molecular Formula | C14H17BrIN3O |
| Molecular Weight | 450.12 g/mol |
| Exact Mass | 448.96 |
| IUPAC Name | [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-iodophenyl)methanol |
| SMILES | CN(C)CCn1ncc(Br)c1C(O)c1ccccc1I |
| InChI | InChI=1S/C14H17BrIN3O/c1-18(2)7-8-19-13(11(15)9-17-19)14(20)10-5-3-4-6-12(10)16/h3-6,9,14,20H,7-8H2,1-2H3 |
| InChIKey | MEVBYHRNHRMVFC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.12 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|