C13H18BrN3O2 — CID 114645515
[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-methylfuran-3-yl)methanol (PubChem CID 114645515) has the molecular formula C13H18BrN3O2 and a molecular weight of 328.21 g/mol. Its IUPAC name is [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-methylfuran-3-yl)methanol.
| Compound Name | [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-methylfuran-3-yl)methanol |
|---|---|
| PubChem CID | 114645515 |
| Molecular Formula | C13H18BrN3O2 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-methylfuran-3-yl)methanol |
| SMILES | Cc1occc1C(O)c1c(Br)cnn1CCN(C)C |
| InChI | InChI=1S/C13H18BrN3O2/c1-9-10(4-7-19-9)13(18)12-11(14)8-15-17(12)6-5-16(2)3/h4,7-8,13,18H,5-6H2,1-3H3 |
| InChIKey | WGDFOECVOCILCN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |