C14H16Br2ClN3O — CID 114638567
(4-bromo-2-chlorophenyl)-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanol (PubChem CID 114638567) has the molecular formula C14H16Br2ClN3O and a molecular weight of 437.56 g/mol. Its IUPAC name is (4-bromo-2-chlorophenyl)-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanol.
| Compound Name | (4-bromo-2-chlorophenyl)-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanol |
|---|---|
| PubChem CID | 114638567 |
| Molecular Formula | C14H16Br2ClN3O |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 434.93 |
| IUPAC Name | (4-bromo-2-chlorophenyl)-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanol |
| SMILES | CN(C)CCn1ncc(Br)c1C(O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H16Br2ClN3O/c1-19(2)5-6-20-13(11(16)8-18-20)14(21)10-4-3-9(15)7-12(10)17/h3-4,7-8,14,21H,5-6H2,1-2H3 |
| InChIKey | XWSAYGZJIQGLSK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |