C15H19Cl2N3O — CID 106859518
[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-chloro-4-methylphenyl)methanol (PubChem CID 106859518) has the molecular formula C15H19Cl2N3O and a molecular weight of 328.24 g/mol. Its IUPAC name is [4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-chloro-4-methylphenyl)methanol.
| Compound Name | [4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-chloro-4-methylphenyl)methanol |
|---|---|
| PubChem CID | 106859518 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | [4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-chloro-4-methylphenyl)methanol |
| SMILES | Cc1ccc(C(O)c2c(Cl)cnn2CCN(C)C)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2N3O/c1-10-4-5-11(12(16)8-10)15(21)14-13(17)9-18-20(14)7-6-19(2)3/h4-5,8-9,15,21H,6-7H2,1-3H3 |
| InChIKey | XOHAQOAUKWJKFG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |