C13H16Cl2N4O — CID 114644946
[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-chloro-4-pyridinyl)methanol (PubChem CID 114644946) has the molecular formula C13H16Cl2N4O and a molecular weight of 315.20 g/mol. Its IUPAC name is [4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-chloro-4-pyridinyl)methanol.
| Compound Name | [4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-chloro-4-pyridinyl)methanol |
|---|---|
| PubChem CID | 114644946 |
| Molecular Formula | C13H16Cl2N4O |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | [4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-chloro-4-pyridinyl)methanol |
| SMILES | CN(C)CCn1ncc(Cl)c1C(O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N4O/c1-18(2)5-6-19-12(10(14)8-17-19)13(20)9-3-4-16-11(15)7-9/h3-4,7-8,13,20H,5-6H2,1-2H3 |
| InChIKey | UIBLNKYRSMRHDA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|