C9H14ClN3O3 — CID 114636529
2-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-hydroxyacetic acid (PubChem CID 114636529) has the molecular formula C9H14ClN3O3 and a molecular weight of 247.68 g/mol. Its IUPAC name is 2-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-hydroxyacetic acid.
| Compound Name | 2-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 114636529 |
| Molecular Formula | C9H14ClN3O3 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 2-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-hydroxyacetic acid |
| SMILES | CN(C)CCn1ncc(Cl)c1C(O)C(=O)O |
| InChI | InChI=1S/C9H14ClN3O3/c1-12(2)3-4-13-7(6(10)5-11-13)8(14)9(15)16/h5,8,14H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | GUVKPSHSZXGALQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |