C13H24ClN3O2 — CID 114645722
1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-ethoxy-2-methylpropan-1-ol (PubChem CID 114645722) has the molecular formula C13H24ClN3O2 and a molecular weight of 289.81 g/mol. Its IUPAC name is 1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-ethoxy-2-methylpropan-1-ol.
| Compound Name | 1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-ethoxy-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 114645722 |
| Molecular Formula | C13H24ClN3O2 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-ethoxy-2-methylpropan-1-ol |
| SMILES | CCOC(C)(C)C(O)c1c(Cl)cnn1CCN(C)C |
| InChI | InChI=1S/C13H24ClN3O2/c1-6-19-13(2,3)12(18)11-10(14)9-15-17(11)8-7-16(4)5/h9,12,18H,6-8H2,1-5H3 |
| InChIKey | HKYNKFOOJGTIRZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |