C11H20ClN3O2 — CID 114644699
1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-methoxypropan-1-ol (PubChem CID 114644699) has the molecular formula C11H20ClN3O2 and a molecular weight of 261.75 g/mol. Its IUPAC name is 1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-methoxypropan-1-ol.
| Compound Name | 1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-methoxypropan-1-ol |
|---|---|
| PubChem CID | 114644699 |
| Molecular Formula | C11H20ClN3O2 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-methoxypropan-1-ol |
| SMILES | COC(C)C(O)c1c(Cl)cnn1CCN(C)C |
| InChI | InChI=1S/C11H20ClN3O2/c1-8(17-4)11(16)10-9(12)7-13-15(10)6-5-14(2)3/h7-8,11,16H,5-6H2,1-4H3 |
| InChIKey | VSWWUFUMOLNGRS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |