C12H15BrClN3O2 — CID 106859519
(2-bromofuran-3-yl)-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanol (PubChem CID 106859519) has the molecular formula C12H15BrClN3O2 and a molecular weight of 348.63 g/mol. Its IUPAC name is (2-bromofuran-3-yl)-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanol.
| Compound Name | (2-bromofuran-3-yl)-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanol |
|---|---|
| PubChem CID | 106859519 |
| Molecular Formula | C12H15BrClN3O2 |
| Molecular Weight | 348.63 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | (2-bromofuran-3-yl)-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanol |
| SMILES | CN(C)CCn1ncc(Cl)c1C(O)c1ccoc1Br |
| InChI | InChI=1S/C12H15BrClN3O2/c1-16(2)4-5-17-10(9(14)7-15-17)11(18)8-3-6-19-12(8)13/h3,6-7,11,18H,4-5H2,1-2H3 |
| InChIKey | GFACIQLJASHHGQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.63 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |