C12H23BrN4O2 — CID 114657541
1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2,2-dimethoxy-N-methylethanamine (PubChem CID 114657541) has the molecular formula C12H23BrN4O2 and a molecular weight of 335.25 g/mol. Its IUPAC name is 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2,2-dimethoxy-N-methylethanamine.
| Compound Name | 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2,2-dimethoxy-N-methylethanamine |
|---|---|
| PubChem CID | 114657541 |
| Molecular Formula | C12H23BrN4O2 |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2,2-dimethoxy-N-methylethanamine |
| SMILES | CNC(c1c(Br)cnn1CCN(C)C)C(OC)OC |
| InChI | InChI=1S/C12H23BrN4O2/c1-14-10(12(18-4)19-5)11-9(13)8-15-17(11)7-6-16(2)3/h8,10,12,14H,6-7H2,1-5H3 |
| InChIKey | PKDADTQUQGPBDJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|