C13H24BrN3O3 — CID 114657566
N-[1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2,2-dimethoxyethyl]propan-1-amine (PubChem CID 114657566) has the molecular formula C13H24BrN3O3 and a molecular weight of 350.26 g/mol. Its IUPAC name is N-[1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2,2-dimethoxyethyl]propan-1-amine.
| Compound Name | N-[1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2,2-dimethoxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 114657566 |
| Molecular Formula | C13H24BrN3O3 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2,2-dimethoxyethyl]propan-1-amine |
| SMILES | CCCNC(c1c(Br)cnn1CCOC)C(OC)OC |
| InChI | InChI=1S/C13H24BrN3O3/c1-5-6-15-11(13(19-3)20-4)12-10(14)9-16-17(12)7-8-18-2/h9,11,13,15H,5-8H2,1-4H3 |
| InChIKey | JEXZFKOOZWXTHH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|