C11H20BrN3O3S — CID 105043039
1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-methyl-2-methylsulfonylpropan-1-amine (PubChem CID 105043039) has the molecular formula C11H20BrN3O3S and a molecular weight of 354.27 g/mol. Its IUPAC name is 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-methyl-2-methylsulfonylpropan-1-amine.
| Compound Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-methyl-2-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 105043039 |
| Molecular Formula | C11H20BrN3O3S |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-methyl-2-methylsulfonylpropan-1-amine |
| SMILES | CNC(c1c(Br)cnn1CCOC)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H20BrN3O3S/c1-8(19(4,16)17)10(13-2)11-9(12)7-14-15(11)5-6-18-3/h7-8,10,13H,5-6H2,1-4H3 |
| InChIKey | HYTJEFYGRIVSPO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |