C13H18Cl2FNO2 — CID 103785501
3-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-4-methoxybutan-1-ol (PubChem CID 103785501) has the molecular formula C13H18Cl2FNO2 and a molecular weight of 310.20 g/mol. Its IUPAC name is 3-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-4-methoxybutan-1-ol.
| Compound Name | 3-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 103785501 |
| Molecular Formula | C13H18Cl2FNO2 |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-4-methoxybutan-1-ol |
| SMILES | COCC(CCO)NC(C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl2FNO2/c1-8(17-9(3-4-18)7-19-2)10-5-13(16)12(15)6-11(10)14/h5-6,8-9,17-18H,3-4,7H2,1-2H3 |
| InChIKey | FSLRJBNDTNZGCG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|