C13H14Cl2FNO4 — CID 146135575
3-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-2-methoxy-2-methyl-3-oxopropanoic acid (PubChem CID 146135575) has the molecular formula C13H14Cl2FNO4 and a molecular weight of 338.16 g/mol. Its IUPAC name is 3-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-2-methoxy-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-2-methoxy-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 146135575 |
| Molecular Formula | C13H14Cl2FNO4 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 3-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-2-methoxy-2-methyl-3-oxopropanoic acid |
| SMILES | COC(C)(C(=O)O)C(=O)NC(C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2FNO4/c1-6(7-4-10(16)9(15)5-8(7)14)17-11(18)13(2,21-3)12(19)20/h4-6H,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | IHUNULHEWSGRGP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|