4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid

C15H12Cl2FNO2 — CID 43774350

IUPAC4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid
SMILESCC(Nc1ccc(C(=O)O)cc1)c1cc(F)c(Cl)cc1Cl
InChIInChI=1S/C15H12Cl2FNO2/c1-8(11-6-14(18)13(17)7-12(11)16)19-10-4-2-9(3-5-10)15(20)21/h2-8,19H,1H3,(H,20,21)
InChIKeyUZTDZDJZHNIMSL-UHFFFAOYSA-N
MW328.17 g/mol
LogP5.00
Rot. Bonds4

About 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid

4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid (PubChem CID 43774350) has the molecular formula C15H12Cl2FNO2 and a molecular weight of 328.17 g/mol. Its IUPAC name is 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid.

Molecular Properties

Compound Name4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid
PubChem CID43774350
Molecular FormulaC15H12Cl2FNO2
Molecular Weight328.17 g/mol
Exact Mass327.02
IUPAC Name4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid
SMILESCC(Nc1ccc(C(=O)O)cc1)c1cc(F)c(Cl)cc1Cl
InChIInChI=1S/C15H12Cl2FNO2/c1-8(11-6-14(18)13(17)7-12(11)16)19-10-4-2-9(3-5-10)15(20)21/h2-8,19H,1H3,(H,20,21)
InChIKeyUZTDZDJZHNIMSL-UHFFFAOYSA-N
XLogP5.00
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500328.17
LogP ≤ 55.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid?
The IUPAC name of 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid (CID 43774350) is 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid.
What is the SMILES notation for 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid?
The canonical SMILES for 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid is CC(Nc1ccc(C(=O)O)cc1)c1cc(F)c(Cl)cc1Cl.
What is the InChIKey of 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid?
The InChIKey is UZTDZDJZHNIMSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl2FNO2/c1-8(11-6-14(18)13(17)7-12(11)16)19-10-4-2-9(3-5-10)15(20)21/h2-8,19H,1H3,(H,20,21).
What are the key properties of 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid?
4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid has a molecular weight of 328.17 g/mol, XLogP of 5.00, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid is sourced from PubChem (CID 43774350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).