C15H12Cl2FNO2 — CID 43774350
4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid (PubChem CID 43774350) has the molecular formula C15H12Cl2FNO2 and a molecular weight of 328.17 g/mol. Its IUPAC name is 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid.
| Compound Name | 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 43774350 |
| Molecular Formula | C15H12Cl2FNO2 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]benzoic acid |
| SMILES | CC(Nc1ccc(C(=O)O)cc1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2FNO2/c1-8(11-6-14(18)13(17)7-12(11)16)19-10-4-2-9(3-5-10)15(20)21/h2-8,19H,1H3,(H,20,21) |
| InChIKey | UZTDZDJZHNIMSL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|