C16H14Cl2FNO3S — CID 51150883
N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-methylsulfonylbenzamide (PubChem CID 51150883) has the molecular formula C16H14Cl2FNO3S and a molecular weight of 390.26 g/mol. Its IUPAC name is N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-methylsulfonylbenzamide.
| Compound Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 51150883 |
| Molecular Formula | C16H14Cl2FNO3S |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-methylsulfonylbenzamide |
| SMILES | CC(NC(=O)c1ccccc1S(C)(=O)=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl2FNO3S/c1-9(11-7-14(19)13(18)8-12(11)17)20-16(21)10-5-3-4-6-15(10)24(2,22)23/h3-9H,1-2H3,(H,20,21) |
| InChIKey | XLUSYHSXXZOSFQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|