C20H21Cl2FN2O2S — CID 112764226
N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzamide (PubChem CID 112764226) has the molecular formula C20H21Cl2FN2O2S and a molecular weight of 443.37 g/mol. Its IUPAC name is N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzamide.
| Compound Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 112764226 |
| Molecular Formula | C20H21Cl2FN2O2S |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzamide |
| SMILES | CC(C)NC(=O)CSc1ccccc1C(=O)NC(C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H21Cl2FN2O2S/c1-11(2)24-19(26)10-28-18-7-5-4-6-13(18)20(27)25-12(3)14-8-17(23)16(22)9-15(14)21/h4-9,11-12H,10H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | NPRHZGJAQBZGKX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|