C16H13Cl2FN2O3S — CID 9232383
N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-(4-nitrophenyl)sulfanylacetamide (PubChem CID 9232383) has the molecular formula C16H13Cl2FN2O3S and a molecular weight of 403.26 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-(4-nitrophenyl)sulfanylacetamide.
| Compound Name | N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-(4-nitrophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 9232383 |
| Molecular Formula | C16H13Cl2FN2O3S |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-(4-nitrophenyl)sulfanylacetamide |
| SMILES | C[C@@H](NC(=O)CSc1ccc([N+](=O)[O-])cc1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2FN2O3S/c1-9(12-6-15(19)14(18)7-13(12)17)20-16(22)8-25-11-4-2-10(3-5-11)21(23)24/h2-7,9H,8H2,1H3,(H,20,22)/t9-/m1/s1 |
| InChIKey | MRXFPHHYFCXXJX-SECBINFHSA-N |
| XLogP | 5.01 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|